Ch3Cooh + Cu(Oh)2 → (Ch3Coo)2Cu + H2O
| Enter a chemical equation lớn balance: |
| Error: equation Cu(OH)2+CH3COOH=CH3COOCu+H2O is an impossible reactionPlease correct your reaction or click on one of the suggestions below: Cu(OH)2 + CH3COOH = Cu(CH3COO)2 + H2OCu(OH)2 + CH3COOH = Cu(C2H3O2)2 + H2OCu(OH)2 + CH3COOH = (CH3COO)2Cu + H2OInstructions và examples below may help khổng lồ solve this problemYou can always ask for help in the forum |
| Bạn đang xem: Ch3cooh + cu(oh)2 → (ch3coo)2cu + h2o Instructions on balancing chemical equations:Enter an equation of a chemical reaction & click "Balance". The answer will appear belowAlways use the upper case for the first character in the element name and the lower case for the second character.Examples: Fe, Au, Co, Br, C, O, N, F. Compare: co - cobalt và CO - carbon monoxideTo enter an electron into a chemical equation use - or e lớn enter an ion, specify charge after the compound in curly brackets: +3 or 3+ or 3. Example: Fe3+ + I- = Fe2+ + I2Substitute immutable groups in chemical compounds to avoid ambiguity. For instance equation C6H5C2H5 + O2 = C6H5OH + CO2 + H2O will not be balanced, but PhC2H5 + O2 = PhOH + CO2 + H2O willCompound states |
| chemical equations balanced today |
Xem thêm: Hướng Dẫn Phân Biệt Các Loại Xoài Ở Việt Nam Và Cách Phân Biệt Chọn Mua
| Chemistrytools |
| Gas laws |
| Unitconverters |
| Periodictable |
| Chemicalforum |
| Constants |
| Symmetry |
| Contribute |
| liên hệ us |
Xem thêm: Lấy Xăng Từ Xe Máy Từ Xe Này Sang Xe Khác Trong 1" Xong, 5 Cách Rút Xăng Xe Máy Đơn Giản Và Nhanh Chóng menu Balance Molar mass Gas laws Units Chemistrytools Periodictable Chemicalforum Symmetry Constants Contribute liên hệ us cameraminhtan.vn is a web application with a mission khổng lồ provide best-in-class chemistry tools and information lớn chemists và students. By using this website, you signify your acceptance of Terms and Conditions và Privacy Policy.Do Not Sell My Personal Information |
